C29H25N5O — CID 122496317
(5aS,6S,9aR)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496317) has the molecular formula C29H25N5O and a molecular weight of 459.55 g/mol. Its IUPAC name is (5aS,6S,9aR)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496317 |
| Molecular Formula | C29H25N5O |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | (5aS,6S,9aR)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(c3ccccc3)c3nc(-c4cnn(C)c4)n(-c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C29H25N5O/c1-19-24-13-14-25-27(29(24,15-20(16-30)26(19)35)22-9-5-3-6-10-22)32-28(21-17-31-33(2)18-21)34(25)23-11-7-4-8-12-23/h3-12,15,17-19,24H,13-14H2,1-2H3/t19-,24-,29+/m0/s1 |
| InChIKey | COMMVRRTMUEGIH-OGWZEYOOSA-N |
| XLogP | 4.79 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |