C20H19N3O — CID 122496326
(5aS,6S,9aR)-6,9a-dimethyl-7-oxo-2-phenyl-4,5,5a,6-tetrahydro-3H-benzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496326) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-2-phenyl-4,5,5a,6-tetrahydro-3H-benzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-2-phenyl-4,5,5a,6-tetrahydro-3H-benzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496326 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-2-phenyl-4,5,5a,6-tetrahydro-3H-benzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)c3nc(-c4ccccc4)[nH]c3CC[C@@H]12 |
| InChI | InChI=1S/C20H19N3O/c1-12-15-8-9-16-18(20(15,2)10-14(11-21)17(12)24)23-19(22-16)13-6-4-3-5-7-13/h3-7,10,12,15H,8-9H2,1-2H3,(H,22,23)/t12-,15-,20-/m0/s1 |
| InChIKey | JFLBNGHWHLJYCQ-LCMPSIMXSA-N |
| XLogP | 3.57 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |