C21H21N3O — CID 122496330
(5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496330) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496330 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | Cc1nc2c(n1-c1ccccc1)CC[C@H]1[C@H](C)C(=O)C(C#N)=C[C@]21C |
| InChI | InChI=1S/C21H21N3O/c1-13-17-9-10-18-20(21(17,3)11-15(12-22)19(13)25)23-14(2)24(18)16-7-5-4-6-8-16/h4-8,11,13,17H,9-10H2,1-3H3/t13-,17-,21-/m0/s1 |
| InChIKey | OPJUCYCTXHLLOM-GTXQTCRKSA-N |
| XLogP | 3.67 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |