C22H23N3O2 — CID 122496332
(5aS,6S,9aR)-2-(2-hydroxyethyl)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496332) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (5aS,6S,9aR)-2-(2-hydroxyethyl)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-2-(2-hydroxyethyl)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496332 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (5aS,6S,9aR)-2-(2-hydroxyethyl)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)c3nc(CCO)n(-c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C22H23N3O2/c1-14-17-8-9-18-21(22(17,2)12-15(13-23)20(14)27)24-19(10-11-26)25(18)16-6-4-3-5-7-16/h3-7,12,14,17,26H,8-11H2,1-2H3/t14-,17-,22-/m0/s1 |
| InChIKey | XKIJRZKPPVTITE-JKXTWKSPSA-N |
| XLogP | 2.90 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |