C25H34N2O3 — CID 122496343
3-[3-[(5'aS,6'S,9'aS)-2',6',9'a-trimethylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole]-3'-yl]phenyl]propan-1-ol (PubChem CID 122496343) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-[3-[(5'aS,6'S,9'aS)-2',6',9'a-trimethylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole]-3'-yl]phenyl]propan-1-ol.
| Compound Name | 3-[3-[(5'aS,6'S,9'aS)-2',6',9'a-trimethylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole]-3'-yl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 122496343 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 3-[3-[(5'aS,6'S,9'aS)-2',6',9'a-trimethylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole]-3'-yl]phenyl]propan-1-ol |
| SMILES | Cc1nc2c(n1-c1cccc(CCCO)c1)CC[C@H]1[C@H](C)C3(CC[C@]21C)OCCO3 |
| InChI | InChI=1S/C25H34N2O3/c1-17-21-9-10-22-23(24(21,3)11-12-25(17)29-14-15-30-25)26-18(2)27(22)20-8-4-6-19(16-20)7-5-13-28/h4,6,8,16-17,21,28H,5,7,9-15H2,1-3H3/t17-,21-,24-/m0/s1 |
| InChIKey | QWJMTPYGHPZLOZ-JBUDQFAYSA-N |
| XLogP | 4.10 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |