C23H23N7O — CID 122496354
(5aS,6S,9aR)-6,9a-dimethyl-2-(2-methylphenyl)-3-(2-methyltetrazol-5-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496354) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is (5aS,6S,9aR)-6,9a-dimethyl-2-(2-methylphenyl)-3-(2-methyltetrazol-5-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-6,9a-dimethyl-2-(2-methylphenyl)-3-(2-methyltetrazol-5-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496354 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (5aS,6S,9aR)-6,9a-dimethyl-2-(2-methylphenyl)-3-(2-methyltetrazol-5-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | Cc1ccccc1-c1nc2c(n1-c1nnn(C)n1)CC[C@H]1[C@H](C)C(=O)C(C#N)=C[C@]21C |
| InChI | InChI=1S/C23H23N7O/c1-13-7-5-6-8-16(13)21-25-20-18(30(21)22-26-28-29(4)27-22)10-9-17-14(2)19(31)15(12-24)11-23(17,20)3/h5-8,11,14,17H,9-10H2,1-4H3/t14-,17-,23-/m0/s1 |
| InChIKey | WRCVRGHMAJEIFC-GJYADEQXSA-N |
| XLogP | 2.86 |
| TPSA | 102.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |