C21H18N4O — CID 122496355
(5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-2,8-dicarbonitrile (PubChem CID 122496355) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-2,8-dicarbonitrile.
| Compound Name | (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-2,8-dicarbonitrile |
|---|---|
| PubChem CID | 122496355 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-2,8-dicarbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)c3nc(C#N)n(-c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C21H18N4O/c1-13-16-8-9-17-20(21(16,2)10-14(11-22)19(13)26)24-18(12-23)25(17)15-6-4-3-5-7-15/h3-7,10,13,16H,8-9H2,1-2H3/t13-,16-,21-/m0/s1 |
| InChIKey | KBMYFTWDYFUZGV-PCMMCCAGSA-N |
| XLogP | 3.23 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |