C25H22N4O — CID 122496358
(5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-2-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496358) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-2-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-2-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496358 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (5aS,6S,9aR)-6,9a-dimethyl-7-oxo-3-phenyl-2-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)c3nc(-c4ccncc4)n(-c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C25H22N4O/c1-16-20-8-9-21-23(25(20,2)14-18(15-26)22(16)30)28-24(17-10-12-27-13-11-17)29(21)19-6-4-3-5-7-19/h3-7,10-14,16,20H,8-9H2,1-2H3/t16-,20-,25-/m0/s1 |
| InChIKey | YCDRBMNLCNWUMA-BLRRAGTOSA-N |
| XLogP | 4.42 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |