C6H7N3O3 — CID 122496393
5-(methyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 122496393) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 5-(methyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(methyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 122496393 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 5-(methyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H7N3O3/c1-7-2-3-4(10)8-6(12)9-5(3)11/h2-3H,1H3,(H2,8,9,10,11,12)/b7-2+ |
| InChIKey | MOHWPCZTOSOZSD-FARCUNLSSA-N |
| XLogP | -1.33 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|