About 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid
4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid (PubChem CID 1224966) has the molecular formula C14H15BrN2O2S
and a molecular weight of 355.26 g/mol. Its IUPAC name is 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid |
| PubChem CID | 1224966 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C14H15BrN2O2S/c1-17(8-2-3-13(18)19)14-16-12(9-20-14)10-4-6-11(15)7-5-10/h4-7,9H,2-3,8H2,1H3,(H,18,19) |
| InChIKey | VJTYPHOPRVYWNE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid?
The IUPAC name of 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid (CID 1224966) is 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid.
What is the SMILES notation for 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid?
The canonical SMILES for 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid is CN(CCCC(=O)O)c1nc(-c2ccc(Br)cc2)cs1.
What is the InChIKey of 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid?
The InChIKey is VJTYPHOPRVYWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2O2S/c1-17(8-2-3-13(18)19)14-16-12(9-20-14)10-4-6-11(15)7-5-10/h4-7,9H,2-3,8H2,1H3,(H,18,19).
What are the key properties of 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid?
4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid has a molecular weight of 355.26 g/mol, XLogP of 3.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-methylamino]butanoic acid is sourced from PubChem (CID 1224966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).