C19H19ClN2O4 — CID 122496774
(2R,3S,4R,5R)-2-[(R)-(3-chlorophenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-b]pyridin-1-yl)oxolane-3,4-diol (PubChem CID 122496774) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(3-chlorophenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-b]pyridin-1-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(3-chlorophenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-b]pyridin-1-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 122496774 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(3-chlorophenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-b]pyridin-1-yl)oxolane-3,4-diol |
| SMILES | Cc1ccnc2c1ccn2[C@@H]1O[C@H]([C@H](O)c2cccc(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19ClN2O4/c1-10-5-7-21-18-13(10)6-8-22(18)19-16(25)15(24)17(26-19)14(23)11-3-2-4-12(20)9-11/h2-9,14-17,19,23-25H,1H3/t14-,15+,16-,17-,19-/m1/s1 |
| InChIKey | GTJNHSDVHIRTNU-FSNPWBFUSA-N |
| XLogP | 2.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |