C19H20FN3O5 — CID 122496930
(2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-methoxyphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 122496930) has the molecular formula C19H20FN3O5 and a molecular weight of 389.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-methoxyphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-methoxyphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 122496930 |
| Molecular Formula | C19H20FN3O5 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-methoxyphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | COc1cc([C@@H](O)[C@H]2O[C@@H](n3ccc4c(C)ncnc43)[C@H](O)[C@@H]2O)ccc1F |
| InChI | InChI=1S/C19H20FN3O5/c1-9-11-5-6-23(18(11)22-8-21-9)19-16(26)15(25)17(28-19)14(24)10-3-4-12(20)13(7-10)27-2/h3-8,14-17,19,24-26H,1-2H3/t14-,15+,16-,17-,19-/m1/s1 |
| InChIKey | FNLLHANIAAGVKP-FSNPWBFUSA-N |
| XLogP | 1.24 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |