C21H20ClF2N3O4 — CID 122497036
(1S)-1-[(4R,6S,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-difluorophenyl)ethanol (PubChem CID 122497036) has the molecular formula C21H20ClF2N3O4 and a molecular weight of 451.86 g/mol. Its IUPAC name is (1S)-1-[(4R,6S,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-difluorophenyl)ethanol.
| Compound Name | (1S)-1-[(4R,6S,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 122497036 |
| Molecular Formula | C21H20ClF2N3O4 |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (1S)-1-[(4R,6S,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-difluorophenyl)ethanol |
| SMILES | CC1(C)OC2[C@H](n3ccc4c(Cl)ncnc43)O[C@H]([C@@](C)(O)c3ccc(F)c(F)c3)[C@H]2O1 |
| InChI | InChI=1S/C21H20ClF2N3O4/c1-20(2)30-14-15(31-20)19(27-7-6-11-17(22)25-9-26-18(11)27)29-16(14)21(3,28)10-4-5-12(23)13(24)8-10/h4-9,14-16,19,28H,1-3H3/t14-,15?,16-,19+,21-/m0/s1 |
| InChIKey | QUIGDEZYWQLQEJ-KQWSWWANSA-N |
| XLogP | 3.69 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |