C12H21NO — CID 122497173
2-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-one (PubChem CID 122497173) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-one.
| Compound Name | 2-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 122497173 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-one |
| SMILES | CC(C)N1CCC2CCCCC2C1=O |
| InChI | InChI=1S/C12H21NO/c1-9(2)13-8-7-10-5-3-4-6-11(10)12(13)14/h9-11H,3-8H2,1-2H3 |
| InChIKey | TXJHRWXJEPOTOQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |