C23H34O2 — CID 122497455
(1R,3aR,7aS)-1-[(E)-4-[(3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]-3-methylbut-2-enyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one (PubChem CID 122497455) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (1R,3aR,7aS)-1-[(E)-4-[(3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]-3-methylbut-2-enyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one.
| Compound Name | (1R,3aR,7aS)-1-[(E)-4-[(3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]-3-methylbut-2-enyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
|---|---|
| PubChem CID | 122497455 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (1R,3aR,7aS)-1-[(E)-4-[(3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]-3-methylbut-2-enyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
| SMILES | C/C(=C\C[C@H]1C(=O)C[C@H]2CCCC[C@@H]21)CC1C(=O)C[C@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C23H34O2/c1-15(12-21-19-9-5-3-7-17(19)14-23(21)25)10-11-20-18-8-4-2-6-16(18)13-22(20)24/h10,16-21H,2-9,11-14H2,1H3/b15-10+/t16-,17-,18+,19+,20-,21?/m1/s1 |
| InChIKey | QSCZVYPUADMFFW-MGMNWWMQSA-N |
| XLogP | 5.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|