C21H26O2 — CID 122498275
4-[4-[(3,5-dimethylphenyl)methoxy]phenyl]cyclohexan-1-ol (PubChem CID 122498275) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-[4-[(3,5-dimethylphenyl)methoxy]phenyl]cyclohexan-1-ol.
| Compound Name | 4-[4-[(3,5-dimethylphenyl)methoxy]phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 122498275 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4-[4-[(3,5-dimethylphenyl)methoxy]phenyl]cyclohexan-1-ol |
| SMILES | Cc1cc(C)cc(COc2ccc(C3CCC(O)CC3)cc2)c1 |
| InChI | InChI=1S/C21H26O2/c1-15-11-16(2)13-17(12-15)14-23-21-9-5-19(6-10-21)18-3-7-20(22)8-4-18/h5-6,9-13,18,20,22H,3-4,7-8,14H2,1-2H3 |
| InChIKey | YMUWULDGIRNMMO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |