C18H26N8 — CID 122498451
N-(3-methyloctan-3-yl)-4,6-di(pyrazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 122498451) has the molecular formula C18H26N8 and a molecular weight of 354.46 g/mol. Its IUPAC name is N-(3-methyloctan-3-yl)-4,6-di(pyrazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-(3-methyloctan-3-yl)-4,6-di(pyrazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 122498451 |
| Molecular Formula | C18H26N8 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | N-(3-methyloctan-3-yl)-4,6-di(pyrazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCCCC(C)(CC)Nc1nc(-n2cccn2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C18H26N8/c1-4-6-7-10-18(3,5-2)24-15-21-16(25-13-8-11-19-25)23-17(22-15)26-14-9-12-20-26/h8-9,11-14H,4-7,10H2,1-3H3,(H,21,22,23,24) |
| InChIKey | GRGICMQFFZYUKD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|