C24H39N3O — CID 122498455
5-(4,12-dimethylpentadecan-7-yl)-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 122498455) has the molecular formula C24H39N3O and a molecular weight of 385.60 g/mol. Its IUPAC name is 5-(4,12-dimethylpentadecan-7-yl)-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4,12-dimethylpentadecan-7-yl)-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 122498455 |
| Molecular Formula | C24H39N3O |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | 5-(4,12-dimethylpentadecan-7-yl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | CCCC(C)CCCCC(CCC(C)CCC)c1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C24H39N3O/c1-5-11-19(3)13-7-8-14-21(17-16-20(4)12-6-2)24-26-23(27-28-24)22-15-9-10-18-25-22/h9-10,15,18-21H,5-8,11-14,16-17H2,1-4H3 |
| InChIKey | CVBHXIUSJHPSMR-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|