C24H43N7 — CID 122498459
2-N,4-N-bis(3-methyloctan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 122498459) has the molecular formula C24H43N7 and a molecular weight of 429.66 g/mol. Its IUPAC name is 2-N,4-N-bis(3-methyloctan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3-methyloctan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 122498459 |
| Molecular Formula | C24H43N7 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | 2-N,4-N-bis(3-methyloctan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCC(C)(CC)Nc1nc(NC(C)(CC)CCCCC)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C24H43N7/c1-7-11-13-16-23(5,9-3)29-20-26-21(28-22(27-20)31-19-15-18-25-31)30-24(6,10-4)17-14-12-8-2/h15,18-19H,7-14,16-17H2,1-6H3,(H2,26,27,28,29,30) |
| InChIKey | KXBXNBCWQVPCJH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|