C24H29FN2O2 — CID 122499269
1-(3-ethylspiro[bicyclo[3.3.1]nonane-6,2'-oxirane]-3-yl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol (PubChem CID 122499269) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-(3-ethylspiro[bicyclo[3.3.1]nonane-6,2'-oxirane]-3-yl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol.
| Compound Name | 1-(3-ethylspiro[bicyclo[3.3.1]nonane-6,2'-oxirane]-3-yl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
|---|---|
| PubChem CID | 122499269 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-(3-ethylspiro[bicyclo[3.3.1]nonane-6,2'-oxirane]-3-yl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
| SMILES | CCC1(C(O)CC2c3c(F)cccc3-c3cncn32)CC2CCC3(CO3)C(C2)C1 |
| InChI | InChI=1S/C24H29FN2O2/c1-2-23(10-15-6-7-24(13-29-24)16(8-15)11-23)21(28)9-19-22-17(4-3-5-18(22)25)20-12-26-14-27(19)20/h3-5,12,14-16,19,21,28H,2,6-11,13H2,1H3 |
| InChIKey | LZBZAAWPLAYREX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|