C24H28F4N2O2 — CID 122499699
3-[2-fluoro-5-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 122499699) has the molecular formula C24H28F4N2O2 and a molecular weight of 452.49 g/mol. Its IUPAC name is 3-[2-fluoro-5-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 122499699 |
| Molecular Formula | C24H28F4N2O2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(O)CC(CCCCCCc1ccc2c(n1)NCCC2)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C24H28F4N2O2/c25-21-12-10-18(24(26,27)28)15-20(21)17(14-22(31)32)6-3-1-2-4-8-19-11-9-16-7-5-13-29-23(16)30-19/h9-12,15,17H,1-8,13-14H2,(H,29,30)(H,31,32) |
| InChIKey | IJUIEQQTBTWZAD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|