C24H29F3N2O2 — CID 122499703
(3S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-[3-(trifluoromethyl)phenyl]nonanoic acid (PubChem CID 122499703) has the molecular formula C24H29F3N2O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is (3S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-[3-(trifluoromethyl)phenyl]nonanoic acid.
| Compound Name | (3S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-[3-(trifluoromethyl)phenyl]nonanoic acid |
|---|---|
| PubChem CID | 122499703 |
| Molecular Formula | C24H29F3N2O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (3S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-[3-(trifluoromethyl)phenyl]nonanoic acid |
| SMILES | O=C(O)C[C@H](CCCCCCc1ccc2c(n1)NCCC2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H29F3N2O2/c25-24(26,27)20-10-5-8-18(15-20)19(16-22(30)31)7-3-1-2-4-11-21-13-12-17-9-6-14-28-23(17)29-21/h5,8,10,12-13,15,19H,1-4,6-7,9,11,14,16H2,(H,28,29)(H,30,31)/t19-/m0/s1 |
| InChIKey | YSRHKDWMDJOMGD-IBGZPJMESA-N |
| XLogP | 6.21 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|