C20H24N2O6S — CID 122499848
1-(3-hydroxy-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea (PubChem CID 122499848) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-(3-hydroxy-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea.
| Compound Name | 1-(3-hydroxy-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea |
|---|---|
| PubChem CID | 122499848 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(3-hydroxy-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea |
| SMILES | CC(C)(O)c1coc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2C(O)CC4)CCC3)c1 |
| InChI | InChI=1S/C20H24N2O6S/c1-20(2,25)13-9-16(28-10-13)29(26,27)22-19(24)21-18-14-5-3-4-11(14)8-12-6-7-15(23)17(12)18/h8-10,15,23,25H,3-7H2,1-2H3,(H2,21,22,24) |
| InChIKey | BJMSWFYEIAQRGM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |