About 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea
1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea (PubChem CID 122499883) has the molecular formula C18H23F3N4O3S
and a molecular weight of 432.47 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea.
Molecular Properties
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea |
| PubChem CID | 122499883 |
| Molecular Formula | C18H23F3N4O3S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)c1cc(C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C18H23F3N4O3S/c1-10(2)12-7-6-8-13(11(3)4)16(12)22-17(26)24-29(27,28)15-9-14(18(19,20)21)25(5)23-15/h6-11H,1-5H3,(H2,22,24,26) |
| InChIKey | XCJCGFDYWDYDHL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea?
The IUPAC name of 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea (CID 122499883) is 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea.
What is the SMILES notation for 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea?
The canonical SMILES for 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea is CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)c1cc(C(F)(F)F)n(C)n1.
What is the InChIKey of 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea?
The InChIKey is XCJCGFDYWDYDHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F3N4O3S/c1-10(2)12-7-6-8-13(11(3)4)16(12)22-17(26)24-29(27,28)15-9-14(18(19,20)21)25(5)23-15/h6-11H,1-5H3,(H2,22,24,26).
What are the key properties of 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea?
1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea has a molecular weight of 432.47 g/mol, XLogP of 4.20, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-di(propan-2-yl)phenyl]-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]sulfonylurea is sourced from PubChem (CID 122499883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).