About 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea
1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea (PubChem CID 122499932) has the molecular formula C18H16N2O7S
and a molecular weight of 404.40 g/mol. Its IUPAC name is 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea.
Molecular Properties
| Compound Name | 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea |
| PubChem CID | 122499932 |
| Molecular Formula | C18H16N2O7S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea |
| SMILES | CC(C)(O)c1coc(S(=O)(=O)NC(=O)Nc2c3ccoc3cc3ccoc23)c1 |
| InChI | InChI=1S/C18H16N2O7S/c1-18(2,22)11-8-14(27-9-11)28(23,24)20-17(21)19-15-12-4-6-25-13(12)7-10-3-5-26-16(10)15/h3-9,22H,1-2H3,(H2,19,20,21) |
| InChIKey | HUHCSYYZOAOXFJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea?
The IUPAC name of 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea (CID 122499932) is 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea.
What is the SMILES notation for 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea?
The canonical SMILES for 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea is CC(C)(O)c1coc(S(=O)(=O)NC(=O)Nc2c3ccoc3cc3ccoc23)c1.
What is the InChIKey of 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea?
The InChIKey is HUHCSYYZOAOXFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O7S/c1-18(2,22)11-8-14(27-9-11)28(23,24)20-17(21)19-15-12-4-6-25-13(12)7-10-3-5-26-16(10)15/h3-9,22H,1-2H3,(H2,19,20,21).
What are the key properties of 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea?
1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea has a molecular weight of 404.40 g/mol, XLogP of 3.51, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-furo[2,3-f][1]benzofuran-4-yl-3-[4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylurea is sourced from PubChem (CID 122499932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).