About 1-benzyl-1,2,4-triazole-3-sulfonyl chloride
1-benzyl-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 122499948) has the molecular formula C9H8ClN3O2S
and a molecular weight of 257.70 g/mol. Its IUPAC name is 1-benzyl-1,2,4-triazole-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-benzyl-1,2,4-triazole-3-sulfonyl chloride |
| PubChem CID | 122499948 |
| Molecular Formula | C9H8ClN3O2S |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 1-benzyl-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C9H8ClN3O2S/c10-16(14,15)9-11-7-13(12-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | NNXDNVFKWLBCIS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-1,2,4-triazole-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1,2,4-triazole-3-sulfonyl chloride?
The IUPAC name of 1-benzyl-1,2,4-triazole-3-sulfonyl chloride (CID 122499948) is 1-benzyl-1,2,4-triazole-3-sulfonyl chloride.
What is the SMILES notation for 1-benzyl-1,2,4-triazole-3-sulfonyl chloride?
The canonical SMILES for 1-benzyl-1,2,4-triazole-3-sulfonyl chloride is O=S(=O)(Cl)c1ncn(Cc2ccccc2)n1.
What is the InChIKey of 1-benzyl-1,2,4-triazole-3-sulfonyl chloride?
The InChIKey is NNXDNVFKWLBCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3O2S/c10-16(14,15)9-11-7-13(12-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2.
What are the key properties of 1-benzyl-1,2,4-triazole-3-sulfonyl chloride?
1-benzyl-1,2,4-triazole-3-sulfonyl chloride has a molecular weight of 257.70 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1,2,4-triazole-3-sulfonyl chloride is sourced from PubChem (CID 122499948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).