About [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate
[(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate (PubChem CID 122499993) has the molecular formula C23H35F3O4
and a molecular weight of 432.52 g/mol. Its IUPAC name is [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate.
Molecular Properties
| Compound Name | [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate |
| PubChem CID | 122499993 |
| Molecular Formula | C23H35F3O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate |
| SMILES | CC(C)(C)C[C@](C(=O)OCOC1C2CC3CC(C[C@H]1C3)C2=O)(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C23H35F3O4/c1-20(2,3)11-22(21(4,5)6,23(24,25)26)19(28)30-12-29-18-15-8-13-7-14(10-15)17(27)16(18)9-13/h13-16,18H,7-12H2,1-6H3/t13?,14?,15-,16?,18?,22+/m1/s1 |
| InChIKey | YJVZDQURBDRPLK-VEJPKKGOSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate?
The IUPAC name of [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate (CID 122499993) is [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate.
What is the SMILES notation for [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate?
The canonical SMILES for [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate is CC(C)(C)C[C@](C(=O)OCOC1C2CC3CC(C[C@H]1C3)C2=O)(C(C)(C)C)C(F)(F)F.
What is the InChIKey of [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate?
The InChIKey is YJVZDQURBDRPLK-VEJPKKGOSA-N. The full InChI is InChI=1S/C23H35F3O4/c1-20(2,3)11-22(21(4,5)6,23(24,25)26)19(28)30-12-29-18-15-8-13-7-14(10-15)17(27)16(18)9-13/h13-16,18H,7-12H2,1-6H3/t13?,14?,15-,16?,18?,22+/m1/s1.
What are the key properties of [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate?
[(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate has a molecular weight of 432.52 g/mol, XLogP of 5.54, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-4-oxo-2-adamantyl]oxymethyl (2R)-2-tert-butyl-4,4-dimethyl-2-(trifluoromethyl)pentanoate is sourced from PubChem (CID 122499993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).