C23H34N8O2 — CID 122500176
4-[amino-[(1R,3R)-2,2,3-trimethylcyclopentyl]amino]-6-[5-(2,2-dimethylpropylamino)-1,3,4-oxadiazol-2-yl]pyrrolo[1,2-b]pyridazine-3-carboxamide (PubChem CID 122500176) has the molecular formula C23H34N8O2 and a molecular weight of 454.58 g/mol. Its IUPAC name is 4-[amino-[(1R,3R)-2,2,3-trimethylcyclopentyl]amino]-6-[5-(2,2-dimethylpropylamino)-1,3,4-oxadiazol-2-yl]pyrrolo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 4-[amino-[(1R,3R)-2,2,3-trimethylcyclopentyl]amino]-6-[5-(2,2-dimethylpropylamino)-1,3,4-oxadiazol-2-yl]pyrrolo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 122500176 |
| Molecular Formula | C23H34N8O2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 4-[amino-[(1R,3R)-2,2,3-trimethylcyclopentyl]amino]-6-[5-(2,2-dimethylpropylamino)-1,3,4-oxadiazol-2-yl]pyrrolo[1,2-b]pyridazine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](N(N)c2c(C(N)=O)cnn3cc(-c4nnc(NCC(C)(C)C)o4)cc23)C1(C)C |
| InChI | InChI=1S/C23H34N8O2/c1-13-7-8-17(23(13,5)6)31(25)18-15(19(24)32)10-27-30-11-14(9-16(18)30)20-28-29-21(33-20)26-12-22(2,3)4/h9-11,13,17H,7-8,12,25H2,1-6H3,(H2,24,32)(H,26,29)/t13-,17-/m1/s1 |
| InChIKey | RVJOTUKFHDUCLM-CXAGYDPISA-N |
| XLogP | 3.45 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|