C17H11F2NO7S2 — CID 122500262
6-[(3,4-difluorobenzoyl)amino]naphthalene-1,3-disulfonic acid (PubChem CID 122500262) has the molecular formula C17H11F2NO7S2 and a molecular weight of 443.41 g/mol. Its IUPAC name is 6-[(3,4-difluorobenzoyl)amino]naphthalene-1,3-disulfonic acid.
| Compound Name | 6-[(3,4-difluorobenzoyl)amino]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 122500262 |
| Molecular Formula | C17H11F2NO7S2 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 6-[(3,4-difluorobenzoyl)amino]naphthalene-1,3-disulfonic acid |
| SMILES | O=C(Nc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H11F2NO7S2/c18-14-4-1-9(7-15(14)19)17(21)20-11-2-3-13-10(5-11)6-12(28(22,23)24)8-16(13)29(25,26)27/h1-8H,(H,20,21)(H,22,23,24)(H,25,26,27) |
| InChIKey | APMUPCBHHRWAIB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|