C17H9F4NO7S2 — CID 122500264
6-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalene-1,3-disulfonic acid (PubChem CID 122500264) has the molecular formula C17H9F4NO7S2 and a molecular weight of 479.39 g/mol. Its IUPAC name is 6-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalene-1,3-disulfonic acid.
| Compound Name | 6-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 122500264 |
| Molecular Formula | C17H9F4NO7S2 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.98 |
| IUPAC Name | 6-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalene-1,3-disulfonic acid |
| SMILES | O=C(Nc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H9F4NO7S2/c18-12-6-11(14(19)16(21)15(12)20)17(23)22-8-1-2-10-7(3-8)4-9(30(24,25)26)5-13(10)31(27,28)29/h1-6H,(H,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | UAXGSWOAXDQKEC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|