C18H17F3OS2 — CID 122500540
5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dithiane (PubChem CID 122500540) has the molecular formula C18H17F3OS2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dithiane.
| Compound Name | 5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 122500540 |
| Molecular Formula | C18H17F3OS2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dithiane |
| SMILES | COCC1CSC(c2ccc(-c3cc(F)c(F)c(F)c3)cc2)SC1 |
| InChI | InChI=1S/C18H17F3OS2/c1-22-8-11-9-23-18(24-10-11)13-4-2-12(3-5-13)14-6-15(19)17(21)16(20)7-14/h2-7,11,18H,8-10H2,1H3 |
| InChIKey | ROLUNMBTJSLLII-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|