C21H20F4OS — CID 122500557
5-but-3-enoxy-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]thiane (PubChem CID 122500557) has the molecular formula C21H20F4OS and a molecular weight of 396.45 g/mol. Its IUPAC name is 5-but-3-enoxy-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]thiane.
| Compound Name | 5-but-3-enoxy-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]thiane |
|---|---|
| PubChem CID | 122500557 |
| Molecular Formula | C21H20F4OS |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 5-but-3-enoxy-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]thiane |
| SMILES | C=CCCOC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)SC1 |
| InChI | InChI=1S/C21H20F4OS/c1-2-3-8-26-15-5-7-20(27-12-15)13-4-6-16(17(22)9-13)14-10-18(23)21(25)19(24)11-14/h2,4,6,9-11,15,20H,1,3,5,7-8,12H2 |
| InChIKey | MJVWKQFCZZMRFS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|