C23H30F4OS2 — CID 122500566
2-[4-[4-(2,2-difluoroethenyl)-3,5-difluorophenyl]cyclohexyl]-5-(2-propoxyethyl)-1,3-dithiane (PubChem CID 122500566) has the molecular formula C23H30F4OS2 and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-[4-[4-(2,2-difluoroethenyl)-3,5-difluorophenyl]cyclohexyl]-5-(2-propoxyethyl)-1,3-dithiane.
| Compound Name | 2-[4-[4-(2,2-difluoroethenyl)-3,5-difluorophenyl]cyclohexyl]-5-(2-propoxyethyl)-1,3-dithiane |
|---|---|
| PubChem CID | 122500566 |
| Molecular Formula | C23H30F4OS2 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[4-[4-(2,2-difluoroethenyl)-3,5-difluorophenyl]cyclohexyl]-5-(2-propoxyethyl)-1,3-dithiane |
| SMILES | CCCOCCC1CSC(C2CCC(c3cc(F)c(C=C(F)F)c(F)c3)CC2)SC1 |
| InChI | InChI=1S/C23H30F4OS2/c1-2-8-28-9-7-15-13-29-23(30-14-15)17-5-3-16(4-6-17)18-10-20(24)19(12-22(26)27)21(25)11-18/h10-12,15-17,23H,2-9,13-14H2,1H3 |
| InChIKey | SVYKVBHCFWPQED-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|