About 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile
4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile (PubChem CID 122500672) has the molecular formula C21H25F2NOS
and a molecular weight of 377.50 g/mol. Its IUPAC name is 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile |
| PubChem CID | 122500672 |
| Molecular Formula | C21H25F2NOS |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile |
| SMILES | CCOCC1CCC(C2CC=C(c3cc(F)c(C#N)c(F)c3)CC2)SC1 |
| InChI | InChI=1S/C21H25F2NOS/c1-2-25-12-14-3-8-21(26-13-14)16-6-4-15(5-7-16)17-9-19(22)18(11-24)20(23)10-17/h4,9-10,14,16,21H,2-3,5-8,12-13H2,1H3 |
| InChIKey | DBJHYVLOOXCIKS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile?
The IUPAC name of 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile (CID 122500672) is 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile.
What is the SMILES notation for 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile?
The canonical SMILES for 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile is CCOCC1CCC(C2CC=C(c3cc(F)c(C#N)c(F)c3)CC2)SC1.
What is the InChIKey of 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile?
The InChIKey is DBJHYVLOOXCIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2NOS/c1-2-25-12-14-3-8-21(26-13-14)16-6-4-15(5-7-16)17-9-19(22)18(11-24)20(23)10-17/h4,9-10,14,16,21H,2-3,5-8,12-13H2,1H3.
What are the key properties of 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile?
4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile has a molecular weight of 377.50 g/mol, XLogP of 5.57, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[5-(ethoxymethyl)thian-2-yl]cyclohexen-1-yl]-2,6-difluorobenzonitrile is sourced from PubChem (CID 122500672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).