About tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate
tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate (PubChem CID 122501340) has the molecular formula C22H31FN4O2
and a molecular weight of 402.51 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate |
| PubChem CID | 122501340 |
| Molecular Formula | C22H31FN4O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)c1cc(-c2ccc(F)cc2)nc(C(C)(N)CN)c1 |
| InChI | InChI=1S/C22H31FN4O2/c1-20(2,3)29-19(28)27-21(4,5)15-11-17(14-7-9-16(23)10-8-14)26-18(12-15)22(6,25)13-24/h7-12H,13,24-25H2,1-6H3,(H,27,28) |
| InChIKey | YTBOPHFELUAITP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate (CID 122501340) is tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate is CC(C)(C)OC(=O)NC(C)(C)c1cc(-c2ccc(F)cc2)nc(C(C)(N)CN)c1.
What is the InChIKey of tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate?
The InChIKey is YTBOPHFELUAITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31FN4O2/c1-20(2,3)29-19(28)27-21(4,5)15-11-17(14-7-9-16(23)10-8-14)26-18(12-15)22(6,25)13-24/h7-12H,13,24-25H2,1-6H3,(H,27,28).
What are the key properties of tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate?
tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate has a molecular weight of 402.51 g/mol, XLogP of 3.78, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[2-(1,2-diaminopropan-2-yl)-6-(4-fluorophenyl)-4-pyridinyl]propan-2-yl]carbamate is sourced from PubChem (CID 122501340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).