C13H17ClN2 — CID 122501472
8-chloro-4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-1,7-naphthyridine (PubChem CID 122501472) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 8-chloro-4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-1,7-naphthyridine.
| Compound Name | 8-chloro-4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-1,7-naphthyridine |
|---|---|
| PubChem CID | 122501472 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 8-chloro-4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-1,7-naphthyridine |
| SMILES | C=C(C)c1cc2c(c(Cl)n1)NCCC2(C)C |
| InChI | InChI=1S/C13H17ClN2/c1-8(2)10-7-9-11(12(14)16-10)15-6-5-13(9,3)4/h7,15H,1,5-6H2,2-4H3 |
| InChIKey | RWEOEJNIJJPMFA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|