C14H16ClF3N2O2 — CID 122501488
3-amino-2-[(3R)-7-chloro-3-cyclopropyl-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 122501488) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is 3-amino-2-[(3R)-7-chloro-3-cyclopropyl-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-[(3R)-7-chloro-3-cyclopropyl-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 122501488 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-amino-2-[(3R)-7-chloro-3-cyclopropyl-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@]1(C2CC2)COc2c1cc(C(O)(CN)C(F)(F)F)nc2Cl |
| InChI | InChI=1S/C14H16ClF3N2O2/c1-12(7-2-3-7)6-22-10-8(12)4-9(20-11(10)15)13(21,5-19)14(16,17)18/h4,7,21H,2-3,5-6,19H2,1H3/t12-,13?/m1/s1 |
| InChIKey | KSBCHYHGAWKHJL-PZORYLMUSA-N |
| XLogP | 2.50 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|