C22H26FN3O5S — CID 122501495
2-[1'-tert-butylsulfinyl-7-(4-fluorophenyl)spiro[2H-furo[2,3-c]pyridine-3,2'-azetidine]-5-yl]-1-nitropropan-2-ol (PubChem CID 122501495) has the molecular formula C22H26FN3O5S and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[1'-tert-butylsulfinyl-7-(4-fluorophenyl)spiro[2H-furo[2,3-c]pyridine-3,2'-azetidine]-5-yl]-1-nitropropan-2-ol.
| Compound Name | 2-[1'-tert-butylsulfinyl-7-(4-fluorophenyl)spiro[2H-furo[2,3-c]pyridine-3,2'-azetidine]-5-yl]-1-nitropropan-2-ol |
|---|---|
| PubChem CID | 122501495 |
| Molecular Formula | C22H26FN3O5S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[1'-tert-butylsulfinyl-7-(4-fluorophenyl)spiro[2H-furo[2,3-c]pyridine-3,2'-azetidine]-5-yl]-1-nitropropan-2-ol |
| SMILES | CC(O)(C[N+](=O)[O-])c1cc2c(c(-c3ccc(F)cc3)n1)OCC21CCN1S(=O)C(C)(C)C |
| InChI | InChI=1S/C22H26FN3O5S/c1-20(2,3)32(30)25-10-9-22(25)13-31-19-16(22)11-17(21(4,27)12-26(28)29)24-18(19)14-5-7-15(23)8-6-14/h5-8,11,27H,9-10,12-13H2,1-4H3 |
| InChIKey | AAXFAYLGHZCWJA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|