C19H24F4O5 — CID 122501777
[2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 122501777) has the molecular formula C19H24F4O5 and a molecular weight of 408.39 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 122501777 |
| Molecular Formula | C19H24F4O5 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)COC(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C19H24F4O5/c1-11(2)14(24)27-9-18(20,21)19(22,23)10-28-15(25)16-4-12-3-13(5-16)7-17(26,6-12)8-16/h12-13,26H,1,3-10H2,2H3 |
| InChIKey | HIGHBHLDWDQSPS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|