C19H24F4O4 — CID 122501785
[2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate (PubChem CID 122501785) has the molecular formula C19H24F4O4 and a molecular weight of 392.39 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate.
| Compound Name | [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 122501785 |
| Molecular Formula | C19H24F4O4 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)COC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24F4O4/c1-11(2)15(24)26-9-18(20,21)19(22,23)10-27-16(25)17-6-12-3-13(7-17)5-14(4-12)8-17/h12-14H,1,3-10H2,2H3 |
| InChIKey | UAYBAYWRAOJGDY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|