About [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate
[2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate (PubChem CID 122501796) has the molecular formula C19H26F2O4
and a molecular weight of 356.41 g/mol. Its IUPAC name is [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate.
Molecular Properties
| Compound Name | [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate |
| PubChem CID | 122501796 |
| Molecular Formula | C19H26F2O4 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)COC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H26F2O4/c1-12(2)16(22)24-4-3-19(20,21)11-25-17(23)18-8-13-5-14(9-18)7-15(6-13)10-18/h13-15H,1,3-11H2,2H3 |
| InChIKey | PHKWAEVKFSJRRZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate?
The IUPAC name of [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate (CID 122501796) is [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate.
What is the SMILES notation for [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate?
The canonical SMILES for [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate is C=C(C)C(=O)OCCC(F)(F)COC(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate?
The InChIKey is PHKWAEVKFSJRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26F2O4/c1-12(2)16(22)24-4-3-19(20,21)11-25-17(23)18-8-13-5-14(9-18)7-15(6-13)10-18/h13-15H,1,3-11H2,2H3.
What are the key properties of [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate?
[2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate has a molecular weight of 356.41 g/mol, XLogP of 3.89, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] adamantane-1-carboxylate is sourced from PubChem (CID 122501796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).