About 3,6-dihydropyrrolo[3,2-b]pyrrole
3,6-dihydropyrrolo[3,2-b]pyrrole (PubChem CID 122502596) has the molecular formula C6H6N2
and a molecular weight of 106.13 g/mol. Its IUPAC name is 3,6-dihydropyrrolo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 3,6-dihydropyrrolo[3,2-b]pyrrole |
| PubChem CID | 122502596 |
| Molecular Formula | C6H6N2 |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | 3,6-dihydropyrrolo[3,2-b]pyrrole |
| SMILES | C1=NC2=C(C1)N=CC2 |
| InChI | InChI=1S/C6H6N2/c1-3-7-6-2-4-8-5(1)6/h3-4H,1-2H2 |
| InChIKey | AUSSQIROGNLZBU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dihydropyrrolo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydropyrrolo[3,2-b]pyrrole?
The IUPAC name of 3,6-dihydropyrrolo[3,2-b]pyrrole (CID 122502596) is 3,6-dihydropyrrolo[3,2-b]pyrrole.
What is the SMILES notation for 3,6-dihydropyrrolo[3,2-b]pyrrole?
The canonical SMILES for 3,6-dihydropyrrolo[3,2-b]pyrrole is C1=NC2=C(C1)N=CC2.
What is the InChIKey of 3,6-dihydropyrrolo[3,2-b]pyrrole?
The InChIKey is AUSSQIROGNLZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2/c1-3-7-6-2-4-8-5(1)6/h3-4H,1-2H2.
What are the key properties of 3,6-dihydropyrrolo[3,2-b]pyrrole?
3,6-dihydropyrrolo[3,2-b]pyrrole has a molecular weight of 106.13 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydropyrrolo[3,2-b]pyrrole is sourced from PubChem (CID 122502596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).