About 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole
2,7-dihydrobenzimidazolo[5,4-e]benzimidazole (PubChem CID 122502605) has the molecular formula C12H8N4
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole.
Molecular Properties
| Compound Name | 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole |
| PubChem CID | 122502605 |
| Molecular Formula | C12H8N4 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole |
| SMILES | c1cc2c3c(ccc2c2c1=NCN=2)=NCN=3 |
| InChI | InChI=1S/C12H8N4/c1-3-9-12(16-5-13-9)8-2-4-10-11(7(1)8)15-6-14-10/h1-4H,5-6H2 |
| InChIKey | FLXORJFTLYSKTK-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
The IUPAC name of 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole (CID 122502605) is 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole.
What is the SMILES notation for 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
The canonical SMILES for 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole is c1cc2c3c(ccc2c2c1=NCN=2)=NCN=3.
What is the InChIKey of 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
The InChIKey is FLXORJFTLYSKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4/c1-3-9-12(16-5-13-9)8-2-4-10-11(7(1)8)15-6-14-10/h1-4H,5-6H2.
What are the key properties of 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
2,7-dihydrobenzimidazolo[5,4-e]benzimidazole has a molecular weight of 208.22 g/mol, XLogP of -0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dihydrobenzimidazolo[5,4-e]benzimidazole is sourced from PubChem (CID 122502605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).