C26H24N4O2S3 — CID 122502659
2-[4-(5-methoxy-4-propylthieno[3,2-b]pyrrol-2-yl)-2,1,3-benzothiadiazol-7-yl]-4-propylthieno[3,2-b]pyrrole-5-carbaldehyde (PubChem CID 122502659) has the molecular formula C26H24N4O2S3 and a molecular weight of 520.71 g/mol. Its IUPAC name is 2-[4-(5-methoxy-4-propylthieno[3,2-b]pyrrol-2-yl)-2,1,3-benzothiadiazol-7-yl]-4-propylthieno[3,2-b]pyrrole-5-carbaldehyde.
| Compound Name | 2-[4-(5-methoxy-4-propylthieno[3,2-b]pyrrol-2-yl)-2,1,3-benzothiadiazol-7-yl]-4-propylthieno[3,2-b]pyrrole-5-carbaldehyde |
|---|---|
| PubChem CID | 122502659 |
| Molecular Formula | C26H24N4O2S3 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[4-(5-methoxy-4-propylthieno[3,2-b]pyrrol-2-yl)-2,1,3-benzothiadiazol-7-yl]-4-propylthieno[3,2-b]pyrrole-5-carbaldehyde |
| SMILES | CCCn1c(C=O)cc2sc(-c3ccc(-c4cc5c(cc(OC)n5CCC)s4)c4nsnc34)cc21 |
| InChI | InChI=1S/C26H24N4O2S3/c1-4-8-29-15(14-31)10-22-18(29)11-20(33-22)16-6-7-17(26-25(16)27-35-28-26)21-12-19-23(34-21)13-24(32-3)30(19)9-5-2/h6-7,10-14H,4-5,8-9H2,1-3H3 |
| InChIKey | BNCNWIBNKAITBQ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|