C22H20N4O2S3 — CID 122502660
18-methoxy-3,21-dipropyl-7,12,17-trithia-3,11,13,21-tetrazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),5,10,13,16(20),18-octaene-6-carbaldehyde (PubChem CID 122502660) has the molecular formula C22H20N4O2S3 and a molecular weight of 468.63 g/mol. Its IUPAC name is 18-methoxy-3,21-dipropyl-7,12,17-trithia-3,11,13,21-tetrazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),5,10,13,16(20),18-octaene-6-carbaldehyde.
| Compound Name | 18-methoxy-3,21-dipropyl-7,12,17-trithia-3,11,13,21-tetrazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),5,10,13,16(20),18-octaene-6-carbaldehyde |
|---|---|
| PubChem CID | 122502660 |
| Molecular Formula | C22H20N4O2S3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 18-methoxy-3,21-dipropyl-7,12,17-trithia-3,11,13,21-tetrazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),5,10,13,16(20),18-octaene-6-carbaldehyde |
| SMILES | CCCn1c2cc(C=O)sc2c2c3nsnc3c3c4sc(OC)cc4n(CCC)c3c21 |
| InChI | InChI=1S/C22H20N4O2S3/c1-4-6-25-12-8-11(10-27)29-21(12)15-17-18(24-31-23-17)16-20(19(15)25)26(7-5-2)13-9-14(28-3)30-22(13)16/h8-10H,4-7H2,1-3H3 |
| InChIKey | ZQEZAJPZXZXWEG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|