C29H30F4N4O5 — CID 122502767
N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-cyclopropyloxy-4-(2-hydroxyethoxy)benzamide (PubChem CID 122502767) has the molecular formula C29H30F4N4O5 and a molecular weight of 590.57 g/mol. Its IUPAC name is N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-cyclopropyloxy-4-(2-hydroxyethoxy)benzamide.
| Compound Name | N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-cyclopropyloxy-4-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 122502767 |
| Molecular Formula | C29H30F4N4O5 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-cyclopropyloxy-4-(2-hydroxyethoxy)benzamide |
| SMILES | CC1(N)CNc2c1cc(C(O)(CNC(=O)c1ccc(OCCO)c(OC3CC3)c1)C(F)(F)F)nc2-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H30F4N4O5/c1-27(34)14-35-25-20(27)13-23(37-24(25)16-2-5-18(30)6-3-16)28(40,29(31,32)33)15-36-26(39)17-4-9-21(41-11-10-38)22(12-17)42-19-7-8-19/h2-6,9,12-13,19,35,38,40H,7-8,10-11,14-15,34H2,1H3,(H,36,39) |
| InChIKey | HBOSRTNYMRUUDM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |