C29H32F4N4O6 — CID 122502770
N-[2-[3-amino-7-(4-fluorophenyl)-1,3-dimethyl-2H-pyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxyethoxy)-3,5-dimethoxybenzamide (PubChem CID 122502770) has the molecular formula C29H32F4N4O6 and a molecular weight of 608.59 g/mol. Its IUPAC name is N-[2-[3-amino-7-(4-fluorophenyl)-1,3-dimethyl-2H-pyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxyethoxy)-3,5-dimethoxybenzamide.
| Compound Name | N-[2-[3-amino-7-(4-fluorophenyl)-1,3-dimethyl-2H-pyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxyethoxy)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 122502770 |
| Molecular Formula | C29H32F4N4O6 |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | N-[2-[3-amino-7-(4-fluorophenyl)-1,3-dimethyl-2H-pyrrolo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxyethoxy)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(O)(c2cc3c(c(-c4ccc(F)cc4)n2)N(C)CC3(C)N)C(F)(F)F)cc(OC)c1OCCO |
| InChI | InChI=1S/C29H32F4N4O6/c1-27(34)15-37(2)24-19(27)13-22(36-23(24)16-5-7-18(30)8-6-16)28(40,29(31,32)33)14-35-26(39)17-11-20(41-3)25(43-10-9-38)21(12-17)42-4/h5-8,11-13,38,40H,9-10,14-15,34H2,1-4H3,(H,35,39) |
| InChIKey | HZYRFKSTXFDMFQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |