C28H28F4N4O4 — CID 122502783
N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-8-methoxy-1,2,3,4-tetrahydroquinoline-6-carboxamide (PubChem CID 122502783) has the molecular formula C28H28F4N4O4 and a molecular weight of 560.55 g/mol. Its IUPAC name is N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-8-methoxy-1,2,3,4-tetrahydroquinoline-6-carboxamide.
| Compound Name | N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-8-methoxy-1,2,3,4-tetrahydroquinoline-6-carboxamide |
|---|---|
| PubChem CID | 122502783 |
| Molecular Formula | C28H28F4N4O4 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-8-methoxy-1,2,3,4-tetrahydroquinoline-6-carboxamide |
| SMILES | COc1cc(C(=O)NCC(O)(c2cc3c(c(-c4ccc(F)cc4)n2)OCC3(C)N)C(F)(F)F)cc2c1NCCC2 |
| InChI | InChI=1S/C28H28F4N4O4/c1-26(33)14-40-24-19(26)12-21(36-23(24)15-5-7-18(29)8-6-15)27(38,28(30,31)32)13-35-25(37)17-10-16-4-3-9-34-22(16)20(11-17)39-2/h5-8,10-12,34,38H,3-4,9,13-14,33H2,1-2H3,(H,35,37) |
| InChIKey | QQIWIWVOINWXDW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |