C29H31F4N3O6 — CID 122502893
N-[(2R)-2-[(3S)-3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(3-hydroxypropyl)-3,5-dimethoxybenzamide (PubChem CID 122502893) has the molecular formula C29H31F4N3O6 and a molecular weight of 593.57 g/mol. Its IUPAC name is N-[(2R)-2-[(3S)-3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(3-hydroxypropyl)-3,5-dimethoxybenzamide.
| Compound Name | N-[(2R)-2-[(3S)-3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(3-hydroxypropyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 122502893 |
| Molecular Formula | C29H31F4N3O6 |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[(2R)-2-[(3S)-3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(3-hydroxypropyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC[C@@](O)(c2cc3c(c(-c4ccc(F)cc4)n2)OC[C@@]3(C)N)C(F)(F)F)cc(OC)c1CCCO |
| InChI | InChI=1S/C29H31F4N3O6/c1-27(34)15-42-25-20(27)13-23(36-24(25)16-6-8-18(30)9-7-16)28(39,29(31,32)33)14-35-26(38)17-11-21(40-2)19(5-4-10-37)22(12-17)41-3/h6-9,11-13,37,39H,4-5,10,14-15,34H2,1-3H3,(H,35,38)/t27-,28-/m1/s1 |
| InChIKey | RKXTYCMZYJVGIZ-VSGBNLITSA-N |
| XLogP | 3.58 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |