C31H33F4N3O6 — CID 122503185
N-[2-[4-amino-4-cyclopropyl-8-(4-fluorophenyl)-2,3-dihydropyrano[2,3-c]pyridin-6-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxypropoxy)-3-methoxybenzamide (PubChem CID 122503185) has the molecular formula C31H33F4N3O6 and a molecular weight of 619.61 g/mol. Its IUPAC name is N-[2-[4-amino-4-cyclopropyl-8-(4-fluorophenyl)-2,3-dihydropyrano[2,3-c]pyridin-6-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxypropoxy)-3-methoxybenzamide.
| Compound Name | N-[2-[4-amino-4-cyclopropyl-8-(4-fluorophenyl)-2,3-dihydropyrano[2,3-c]pyridin-6-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxypropoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 122503185 |
| Molecular Formula | C31H33F4N3O6 |
| Molecular Weight | 619.61 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | N-[2-[4-amino-4-cyclopropyl-8-(4-fluorophenyl)-2,3-dihydropyrano[2,3-c]pyridin-6-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-(2-hydroxypropoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(O)(c2cc3c(c(-c4ccc(F)cc4)n2)OCCC3(N)C2CC2)C(F)(F)F)ccc1OCC(C)O |
| InChI | InChI=1S/C31H33F4N3O6/c1-17(39)15-44-23-10-5-19(13-24(23)42-2)28(40)37-16-30(41,31(33,34)35)25-14-22-27(43-12-11-29(22,36)20-6-7-20)26(38-25)18-3-8-21(32)9-4-18/h3-5,8-10,13-14,17,20,39,41H,6-7,11-12,15-16,36H2,1-2H3,(H,37,40) |
| InChIKey | VPYMAQGNDINESI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |